C20H30N2O6Si — CID 173315249
(4-nitrophenyl) (2R)-2-[(2S,3S)-3-[(2R)-1-dimethylsilyloxy-3,3-dimethylbutan-2-yl]-4-oxoazetidin-2-yl]propanoate (PubChem CID 173315249) has the molecular formula C20H30N2O6Si and a molecular weight of 422.55 g/mol. Its IUPAC name is (4-nitrophenyl) (2R)-2-[(2S,3S)-3-[(2R)-1-dimethylsilyloxy-3,3-dimethylbutan-2-yl]-4-oxoazetidin-2-yl]propanoate.
| Compound Name | (4-nitrophenyl) (2R)-2-[(2S,3S)-3-[(2R)-1-dimethylsilyloxy-3,3-dimethylbutan-2-yl]-4-oxoazetidin-2-yl]propanoate |
|---|---|
| PubChem CID | 173315249 |
| Molecular Formula | C20H30N2O6Si |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | (4-nitrophenyl) (2R)-2-[(2S,3S)-3-[(2R)-1-dimethylsilyloxy-3,3-dimethylbutan-2-yl]-4-oxoazetidin-2-yl]propanoate |
| SMILES | C[C@@H](C(=O)Oc1ccc([N+](=O)[O-])cc1)[C@H]1NC(=O)[C@H]1[C@@H](CO[SiH](C)C)C(C)(C)C |
| InChI | InChI=1S/C20H30N2O6Si/c1-12(19(24)28-14-9-7-13(8-10-14)22(25)26)17-16(18(23)21-17)15(20(2,3)4)11-27-29(5)6/h7-10,12,15-17,29H,11H2,1-6H3,(H,21,23)/t12-,15-,16+,17-/m1/s1 |
| InChIKey | WUOJDPPLHZARED-VDNDLQMASA-N |
| XLogP | 2.91 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|