C21H32N2O4SSi — CID 173315029
(3S,4S)-3-[(2R)-1-dimethylsilyloxy-3,3-dimethylbutan-2-yl]-4-[(2R)-4-(4-nitrophenyl)-3-sulfanylidenebutan-2-yl]azetidin-2-one (PubChem CID 173315029) has the molecular formula C21H32N2O4SSi and a molecular weight of 436.65 g/mol. Its IUPAC name is (3S,4S)-3-[(2R)-1-dimethylsilyloxy-3,3-dimethylbutan-2-yl]-4-[(2R)-4-(4-nitrophenyl)-3-sulfanylidenebutan-2-yl]azetidin-2-one.
| Compound Name | (3S,4S)-3-[(2R)-1-dimethylsilyloxy-3,3-dimethylbutan-2-yl]-4-[(2R)-4-(4-nitrophenyl)-3-sulfanylidenebutan-2-yl]azetidin-2-one |
|---|---|
| PubChem CID | 173315029 |
| Molecular Formula | C21H32N2O4SSi |
| Molecular Weight | 436.65 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | (3S,4S)-3-[(2R)-1-dimethylsilyloxy-3,3-dimethylbutan-2-yl]-4-[(2R)-4-(4-nitrophenyl)-3-sulfanylidenebutan-2-yl]azetidin-2-one |
| SMILES | C[C@@H](C(=S)Cc1ccc([N+](=O)[O-])cc1)[C@H]1NC(=O)[C@H]1[C@@H](CO[SiH](C)C)C(C)(C)C |
| InChI | InChI=1S/C21H32N2O4SSi/c1-13(17(28)11-14-7-9-15(10-8-14)23(25)26)19-18(20(24)22-19)16(21(2,3)4)12-27-29(5)6/h7-10,13,16,18-19,29H,11-12H2,1-6H3,(H,22,24)/t13-,16+,18-,19+/m0/s1 |
| InChIKey | OEZMLWGJDSHTOK-KRDRHDLTSA-N |
| XLogP | 3.92 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.65 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|