C21H16F3NO3 — CID 173323908
3-[2,3,6-trifluoro-5-methyl-4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]prop-2-enal (PubChem CID 173323908) has the molecular formula C21H16F3NO3 and a molecular weight of 387.36 g/mol. Its IUPAC name is 3-[2,3,6-trifluoro-5-methyl-4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]prop-2-enal.
| Compound Name | 3-[2,3,6-trifluoro-5-methyl-4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]prop-2-enal |
|---|---|
| PubChem CID | 173323908 |
| Molecular Formula | C21H16F3NO3 |
| Molecular Weight | 387.36 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | 3-[2,3,6-trifluoro-5-methyl-4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]prop-2-enal |
| SMILES | Cc1oc(-c2ccccc2)nc1COc1c(C)c(F)c(C=CC=O)c(F)c1F |
| InChI | InChI=1S/C21H16F3NO3/c1-12-17(22)15(9-6-10-26)18(23)19(24)20(12)27-11-16-13(2)28-21(25-16)14-7-4-3-5-8-14/h3-10H,11H2,1-2H3 |
| InChIKey | TUJUZEDWIMDBQL-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.36 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|