C18H15BrCl2N6O — CID 173324683
N'-[(1Z)-1-[[7-bromo-2-(2,6-dichlorophenyl)pyrazolo[4,3-c]pyridin-4-yl]amino]-3-(hydroxymethyl)buta-1,3-dienyl]methanimidamide (PubChem CID 173324683) has the molecular formula C18H15BrCl2N6O and a molecular weight of 482.17 g/mol. Its IUPAC name is N'-[(1Z)-1-[[7-bromo-2-(2,6-dichlorophenyl)pyrazolo[4,3-c]pyridin-4-yl]amino]-3-(hydroxymethyl)buta-1,3-dienyl]methanimidamide.
| Compound Name | N'-[(1Z)-1-[[7-bromo-2-(2,6-dichlorophenyl)pyrazolo[4,3-c]pyridin-4-yl]amino]-3-(hydroxymethyl)buta-1,3-dienyl]methanimidamide |
|---|---|
| PubChem CID | 173324683 |
| Molecular Formula | C18H15BrCl2N6O |
| Molecular Weight | 482.17 g/mol |
| Exact Mass | 479.99 |
| IUPAC Name | N'-[(1Z)-1-[[7-bromo-2-(2,6-dichlorophenyl)pyrazolo[4,3-c]pyridin-4-yl]amino]-3-(hydroxymethyl)buta-1,3-dienyl]methanimidamide |
| SMILES | C=C(/C=C(\N=CN)Nc1ncc(Br)c2nn(-c3c(Cl)cccc3Cl)cc12)CO |
| InChI | InChI=1S/C18H15BrCl2N6O/c1-10(8-28)5-15(24-9-22)25-18-11-7-27(26-16(11)12(19)6-23-18)17-13(20)3-2-4-14(17)21/h2-7,9,28H,1,8H2,(H2,22,24)(H,23,25)/b15-5+ |
| InChIKey | IESCCBDNCURYHG-PJQLUOCWSA-N |
| XLogP | 4.28 |
| TPSA | 101.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.17 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|