C8H16N2O4 — CID 173325186
tert-butyl N-[[(2R)-2,3-dihydroxypropylidene]amino]carbamate (PubChem CID 173325186) has the molecular formula C8H16N2O4 and a molecular weight of 204.23 g/mol. Its IUPAC name is tert-butyl N-[[(2R)-2,3-dihydroxypropylidene]amino]carbamate.
| Compound Name | tert-butyl N-[[(2R)-2,3-dihydroxypropylidene]amino]carbamate |
|---|---|
| PubChem CID | 173325186 |
| Molecular Formula | C8H16N2O4 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.11 |
| IUPAC Name | tert-butyl N-[[(2R)-2,3-dihydroxypropylidene]amino]carbamate |
| SMILES | CC(C)(C)OC(=O)NN=C[C@@H](O)CO |
| InChI | InChI=1S/C8H16N2O4/c1-8(2,3)14-7(13)10-9-4-6(12)5-11/h4,6,11-12H,5H2,1-3H3,(H,10,13)/t6-/m1/s1 |
| InChIKey | RPUOROCHMMCBQK-ZCFIWIBFSA-N |
| XLogP | -0.15 |
| TPSA | 91.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|