C8H12KO5P2+ — CID 173336767
potassium;hydride;oxo-(2-phenyl-1-phosphonoethoxy)phosphanium (PubChem CID 173336767) has the molecular formula C8H12KO5P2+ and a molecular weight of 289.22 g/mol. Its IUPAC name is potassium;hydride;oxo-(2-phenyl-1-phosphonoethoxy)phosphanium.
| Compound Name | potassium;hydride;oxo-(2-phenyl-1-phosphonoethoxy)phosphanium |
|---|---|
| PubChem CID | 173336767 |
| Molecular Formula | C8H12KO5P2+ |
| Molecular Weight | 289.22 g/mol |
| Exact Mass | 288.98 |
| IUPAC Name | potassium;hydride;oxo-(2-phenyl-1-phosphonoethoxy)phosphanium |
| SMILES | O=[PH+]OC(Cc1ccccc1)P(=O)(O)O.[H-].[K+] |
| InChI | InChI=1S/C8H10O5P2.K.H/c9-14-13-8(15(10,11)12)6-7-4-2-1-3-5-7;;/h1-5,8,14H,6H2,(H-,10,11,12);;/q;+1;-1/p+1 |
| InChIKey | XYCKATUFDCGQJO-UHFFFAOYSA-O |
| XLogP | -1.20 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.22 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|