C9H13NO7 — CID 173342077
2-(2,2-dihydroxyethyl)but-2-enedioic acid;prop-2-enamide (PubChem CID 173342077) has the molecular formula C9H13NO7 and a molecular weight of 247.20 g/mol. Its IUPAC name is 2-(2,2-dihydroxyethyl)but-2-enedioic acid;prop-2-enamide.
| Compound Name | 2-(2,2-dihydroxyethyl)but-2-enedioic acid;prop-2-enamide |
|---|---|
| PubChem CID | 173342077 |
| Molecular Formula | C9H13NO7 |
| Molecular Weight | 247.20 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | 2-(2,2-dihydroxyethyl)but-2-enedioic acid;prop-2-enamide |
| SMILES | C=CC(N)=O.O=C(O)C=C(CC(O)O)C(=O)O |
| InChI | InChI=1S/C6H8O6.C3H5NO/c7-4(8)1-3(6(11)12)2-5(9)10;1-2-3(4)5/h1,5,9-10H,2H2,(H,7,8)(H,11,12);2H,1H2,(H2,4,5) |
| InChIKey | LBXHRTZUVSAAOH-UHFFFAOYSA-N |
| XLogP | -1.56 |
| TPSA | 158.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.20 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|