C16H9F6N5O3S — CID 173356280
[4-[2-[cyano-[[4-(trifluoromethyl)phenyl]diazenyl]methylidene]hydrazinyl]phenyl] trifluoromethanesulfonate (PubChem CID 173356280) has the molecular formula C16H9F6N5O3S and a molecular weight of 465.34 g/mol. Its IUPAC name is [4-[2-[cyano-[[4-(trifluoromethyl)phenyl]diazenyl]methylidene]hydrazinyl]phenyl] trifluoromethanesulfonate.
| Compound Name | [4-[2-[cyano-[[4-(trifluoromethyl)phenyl]diazenyl]methylidene]hydrazinyl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 173356280 |
| Molecular Formula | C16H9F6N5O3S |
| Molecular Weight | 465.34 g/mol |
| Exact Mass | 465.03 |
| IUPAC Name | [4-[2-[cyano-[[4-(trifluoromethyl)phenyl]diazenyl]methylidene]hydrazinyl]phenyl] trifluoromethanesulfonate |
| SMILES | N#CC(=NNc1ccc(OS(=O)(=O)C(F)(F)F)cc1)/N=N/c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H9F6N5O3S/c17-15(18,19)10-1-3-11(4-2-10)24-26-14(9-23)27-25-12-5-7-13(8-6-12)30-31(28,29)16(20,21)22/h1-8,25H/b26-24+,27-14? |
| InChIKey | XVASFQALTBUHBA-HODRBNKMSA-N |
| XLogP | 4.97 |
| TPSA | 116.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.34 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|