C15H8Cl2F3N5 — CID 70614495
1-cyano-N'-(3,4-dichloroanilino)-N-[4-(trifluoromethyl)phenyl]iminomethanimidamide (PubChem CID 70614495) has the molecular formula C15H8Cl2F3N5 and a molecular weight of 386.16 g/mol. Its IUPAC name is 1-cyano-N'-(3,4-dichloroanilino)-N-[4-(trifluoromethyl)phenyl]iminomethanimidamide.
| Compound Name | 1-cyano-N'-(3,4-dichloroanilino)-N-[4-(trifluoromethyl)phenyl]iminomethanimidamide |
|---|---|
| PubChem CID | 70614495 |
| Molecular Formula | C15H8Cl2F3N5 |
| Molecular Weight | 386.16 g/mol |
| Exact Mass | 385.01 |
| IUPAC Name | 1-cyano-N'-(3,4-dichloroanilino)-N-[4-(trifluoromethyl)phenyl]iminomethanimidamide |
| SMILES | N#CC(=NNc1ccc(Cl)c(Cl)c1)/N=N/c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H8Cl2F3N5/c16-12-6-5-11(7-13(12)17)23-25-14(8-21)24-22-10-3-1-9(2-4-10)15(18,19)20/h1-7,23H/b24-22+,25-14? |
| InChIKey | BXSJDVGQQIXHBK-DQFHWOCPSA-N |
| XLogP | 6.05 |
| TPSA | 72.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.16 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|