C36H43N3O6 — CID 173357658
[(3S)-7-amino-1-(9H-fluoren-9-yl)-3-[[(2S)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-phenylpropanoyl]amino]-2-oxoheptyl] formate (PubChem CID 173357658) has the molecular formula C36H43N3O6 and a molecular weight of 613.76 g/mol. Its IUPAC name is [(3S)-7-amino-1-(9H-fluoren-9-yl)-3-[[(2S)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-phenylpropanoyl]amino]-2-oxoheptyl] formate.
| Compound Name | [(3S)-7-amino-1-(9H-fluoren-9-yl)-3-[[(2S)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-phenylpropanoyl]amino]-2-oxoheptyl] formate |
|---|---|
| PubChem CID | 173357658 |
| Molecular Formula | C36H43N3O6 |
| Molecular Weight | 613.76 g/mol |
| Exact Mass | 613.32 |
| IUPAC Name | [(3S)-7-amino-1-(9H-fluoren-9-yl)-3-[[(2S)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-phenylpropanoyl]amino]-2-oxoheptyl] formate |
| SMILES | CN(C(=O)OC(C)(C)C)[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCCCN)C(=O)C(OC=O)C1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C36H43N3O6/c1-36(2,3)45-35(43)39(4)30(22-24-14-6-5-7-15-24)34(42)38-29(20-12-13-21-37)32(41)33(44-23-40)31-27-18-10-8-16-25(27)26-17-9-11-19-28(26)31/h5-11,14-19,23,29-31,33H,12-13,20-22,37H2,1-4H3,(H,38,42)/t29-,30-,33?/m0/s1 |
| InChIKey | AKOQNCRUUDLFND-BVKSZRQYSA-N |
| XLogP | 5.00 |
| TPSA | 128.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.76 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|