C68H108Cl2CuN16O6 — CID 173362433
copper bis(7-carbonochloridoyl-2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane-5-carboxylate) (PubChem CID 173362433) has the molecular formula C68H108Cl2CuN16O6 and a molecular weight of 1380.17 g/mol. Its IUPAC name is copper bis(7-carbonochloridoyl-2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane-5-carboxylate).
| Compound Name | copper bis(7-carbonochloridoyl-2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane-5-carboxylate) |
|---|---|
| PubChem CID | 173362433 |
| Molecular Formula | C68H108Cl2CuN16O6 |
| Molecular Weight | 1380.17 g/mol |
| Exact Mass | 1377.73 |
| IUPAC Name | copper bis(7-carbonochloridoyl-2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane-5-carboxylate) |
| SMILES | O=C(Cl)C1CC(C(=O)[O-])C2C3NC4NC(NC5NC(NC6NC(NC(N3)C2C1)C1CCCCC61)C1CCCCC51)C1CCCCC41.O=C(Cl)C1CC(C(=O)[O-])C2C3NC4NC(NC5NC(NC6NC(NC(N3)C2C1)C1CCCCC61)C1CCCCC51)C1CCCCC41.[Cu+2] |
| InChI | InChI=1S/2C34H55ClN8O3.Cu/c2*35-25(44)15-13-22-24(23(14-15)34(45)46)33-42-31-21-12-6-5-11-20(21)29(40-31)38-27-17-8-2-1-7-16(17)26(36-27)37-28-18-9-3-4-10-19(18)30(39-28)41-32(22)43-33;/h2*15-24,26-33,36-43H,1-14H2,(H,45,46);/q;;+2/p-2 |
| InChIKey | IDFBCRLQSPHVGK-UHFFFAOYSA-L |
| XLogP | 1.14 |
| TPSA | 306.88 Ų |
| H-Bond Donors | 16 |
| H-Bond Acceptors | 22 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 93 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1380.17 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 16 |
| H-Bond Acceptors ≤ 10 | 22 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|