C39H61N5O5 — CID 173369800
(2S,6R)-2-amino-2-[(2R)-2-amino-3-cyclohexylpropanoyl]-3-cyclohexyl-3-[(2S)-1-[(2S)-2,6-diaminohexanoyl]pyrrolidine-2-carbonyl]-4-oxo-6-phenylheptanal (PubChem CID 173369800) has the molecular formula C39H61N5O5 and a molecular weight of 679.95 g/mol. Its IUPAC name is (2S,6R)-2-amino-2-[(2R)-2-amino-3-cyclohexylpropanoyl]-3-cyclohexyl-3-[(2S)-1-[(2S)-2,6-diaminohexanoyl]pyrrolidine-2-carbonyl]-4-oxo-6-phenylheptanal.
| Compound Name | (2S,6R)-2-amino-2-[(2R)-2-amino-3-cyclohexylpropanoyl]-3-cyclohexyl-3-[(2S)-1-[(2S)-2,6-diaminohexanoyl]pyrrolidine-2-carbonyl]-4-oxo-6-phenylheptanal |
|---|---|
| PubChem CID | 173369800 |
| Molecular Formula | C39H61N5O5 |
| Molecular Weight | 679.95 g/mol |
| Exact Mass | 679.47 |
| IUPAC Name | (2S,6R)-2-amino-2-[(2R)-2-amino-3-cyclohexylpropanoyl]-3-cyclohexyl-3-[(2S)-1-[(2S)-2,6-diaminohexanoyl]pyrrolidine-2-carbonyl]-4-oxo-6-phenylheptanal |
| SMILES | C[C@H](CC(=O)C(C(=O)[C@@H]1CCCN1C(=O)[C@@H](N)CCCCN)(C1CCCCC1)[C@](N)(C=O)C(=O)[C@H](N)CC1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C39H61N5O5/c1-27(29-16-7-3-8-17-29)24-34(46)39(30-18-9-4-10-19-30,38(43,26-45)35(47)32(42)25-28-14-5-2-6-15-28)36(48)33-21-13-23-44(33)37(49)31(41)20-11-12-22-40/h3,7-8,16-17,26-28,30-33H,2,4-6,9-15,18-25,40-43H2,1H3/t27-,31+,32-,33+,38+,39?/m1/s1 |
| InChIKey | NZJWNXAKETXJAN-MNHUJJGHSA-N |
| XLogP | 4.10 |
| TPSA | 192.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.95 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|