C18H40O6S2Si — CID 173380042
bis[3-(1,2-diethoxyethoxysulfanyl)propyl]silane (PubChem CID 173380042) has the molecular formula C18H40O6S2Si and a molecular weight of 444.73 g/mol. Its IUPAC name is bis[3-(1,2-diethoxyethoxysulfanyl)propyl]silane.
| Compound Name | bis[3-(1,2-diethoxyethoxysulfanyl)propyl]silane |
|---|---|
| PubChem CID | 173380042 |
| Molecular Formula | C18H40O6S2Si |
| Molecular Weight | 444.73 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | bis[3-(1,2-diethoxyethoxysulfanyl)propyl]silane |
| SMILES | CCOCC(OCC)OSCCC[SiH2]CCCSOC(COCC)OCC |
| InChI | InChI=1S/C18H40O6S2Si/c1-5-19-15-17(21-7-3)23-25-11-9-13-27-14-10-12-26-24-18(22-8-4)16-20-6-2/h17-18H,5-16,27H2,1-4H3 |
| InChIKey | VGCXUJYEVIJQNJ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.73 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|