About bis[3-(1,2-diethoxyethoxysulfanyl)propyl]silane
bis[3-(1,2-diethoxyethoxysulfanyl)propyl]silane (PubChem CID 173380042) has the molecular formula C18H40O6S2Si
and a molecular weight of 444.73 g/mol. Its IUPAC name is bis[3-(1,2-diethoxyethoxysulfanyl)propyl]silane.
Molecular Properties
| Compound Name | bis[3-(1,2-diethoxyethoxysulfanyl)propyl]silane |
| PubChem CID | 173380042 |
| Molecular Formula | C18H40O6S2Si |
| Molecular Weight | 444.73 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | bis[3-(1,2-diethoxyethoxysulfanyl)propyl]silane |
| SMILES | CCOCC(OCC)OSCCC[SiH2]CCCSOC(COCC)OCC |
| InChI | InChI=1S/C18H40O6S2Si/c1-5-19-15-17(21-7-3)23-25-11-9-13-27-14-10-12-26-24-18(22-8-4)16-20-6-2/h17-18H,5-16,27H2,1-4H3 |
| InChIKey | VGCXUJYEVIJQNJ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 444.73 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze bis[3-(1,2-diethoxyethoxysulfanyl)propyl]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[3-(1,2-diethoxyethoxysulfanyl)propyl]silane?
The IUPAC name of bis[3-(1,2-diethoxyethoxysulfanyl)propyl]silane (CID 173380042) is bis[3-(1,2-diethoxyethoxysulfanyl)propyl]silane.
What is the SMILES notation for bis[3-(1,2-diethoxyethoxysulfanyl)propyl]silane?
The canonical SMILES for bis[3-(1,2-diethoxyethoxysulfanyl)propyl]silane is CCOCC(OCC)OSCCC[SiH2]CCCSOC(COCC)OCC.
What is the InChIKey of bis[3-(1,2-diethoxyethoxysulfanyl)propyl]silane?
The InChIKey is VGCXUJYEVIJQNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H40O6S2Si/c1-5-19-15-17(21-7-3)23-25-11-9-13-27-14-10-12-26-24-18(22-8-4)16-20-6-2/h17-18H,5-16,27H2,1-4H3.
What are the key properties of bis[3-(1,2-diethoxyethoxysulfanyl)propyl]silane?
bis[3-(1,2-diethoxyethoxysulfanyl)propyl]silane has a molecular weight of 444.73 g/mol, XLogP of 3.90, 22 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis[3-(1,2-diethoxyethoxysulfanyl)propyl]silane is sourced from PubChem (CID 173380042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).