C25H32Cl2O5 — CID 173392107
ethyl 2-[2-chloro-2-(4-chlorophenoxy)acetyl]oxy-3,7,11-trimethyldodeca-3,6,10-trienoate (PubChem CID 173392107) has the molecular formula C25H32Cl2O5 and a molecular weight of 483.43 g/mol. Its IUPAC name is ethyl 2-[2-chloro-2-(4-chlorophenoxy)acetyl]oxy-3,7,11-trimethyldodeca-3,6,10-trienoate.
| Compound Name | ethyl 2-[2-chloro-2-(4-chlorophenoxy)acetyl]oxy-3,7,11-trimethyldodeca-3,6,10-trienoate |
|---|---|
| PubChem CID | 173392107 |
| Molecular Formula | C25H32Cl2O5 |
| Molecular Weight | 483.43 g/mol |
| Exact Mass | 482.16 |
| IUPAC Name | ethyl 2-[2-chloro-2-(4-chlorophenoxy)acetyl]oxy-3,7,11-trimethyldodeca-3,6,10-trienoate |
| SMILES | CCOC(=O)C(OC(=O)C(Cl)Oc1ccc(Cl)cc1)C(C)=CCC=C(C)CCC=C(C)C |
| InChI | InChI=1S/C25H32Cl2O5/c1-6-30-24(28)22(19(5)12-8-11-18(4)10-7-9-17(2)3)32-25(29)23(27)31-21-15-13-20(26)14-16-21/h9,11-16,22-23H,6-8,10H2,1-5H3 |
| InChIKey | GBFFLSKLYKIXGT-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.43 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|