About butyl N'-[(Z)-hydrazinylidenemethyl]carbamimidothioate;hydrobromide
butyl N'-[(Z)-hydrazinylidenemethyl]carbamimidothioate;hydrobromide (PubChem CID 173402410) has the molecular formula C6H15BrN4S
and a molecular weight of 255.18 g/mol. Its IUPAC name is butyl N'-[(Z)-hydrazinylidenemethyl]carbamimidothioate;hydrobromide.
Molecular Properties
| Compound Name | butyl N'-[(Z)-hydrazinylidenemethyl]carbamimidothioate;hydrobromide |
| PubChem CID | 173402410 |
| Molecular Formula | C6H15BrN4S |
| Molecular Weight | 255.18 g/mol |
| Exact Mass | 254.02 |
| IUPAC Name | butyl N'-[(Z)-hydrazinylidenemethyl]carbamimidothioate;hydrobromide |
| SMILES | Br.CCCCS/C(N)=N/C=N\N |
| InChI | InChI=1S/C6H14N4S.BrH/c1-2-3-4-11-6(7)9-5-10-8;/h5H,2-4,8H2,1H3,(H2,7,9,10);1H |
| InChIKey | SCJDGNVVSRLVLP-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.18 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze butyl N'-[(Z)-hydrazinylidenemethyl]carbamimidothioate;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl N'-[(Z)-hydrazinylidenemethyl]carbamimidothioate;hydrobromide?
The IUPAC name of butyl N'-[(Z)-hydrazinylidenemethyl]carbamimidothioate;hydrobromide (CID 173402410) is butyl N'-[(Z)-hydrazinylidenemethyl]carbamimidothioate;hydrobromide.
What is the SMILES notation for butyl N'-[(Z)-hydrazinylidenemethyl]carbamimidothioate;hydrobromide?
The canonical SMILES for butyl N'-[(Z)-hydrazinylidenemethyl]carbamimidothioate;hydrobromide is Br.CCCCS/C(N)=N/C=N\N.
What is the InChIKey of butyl N'-[(Z)-hydrazinylidenemethyl]carbamimidothioate;hydrobromide?
The InChIKey is SCJDGNVVSRLVLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N4S.BrH/c1-2-3-4-11-6(7)9-5-10-8;/h5H,2-4,8H2,1H3,(H2,7,9,10);1H.
What are the key properties of butyl N'-[(Z)-hydrazinylidenemethyl]carbamimidothioate;hydrobromide?
butyl N'-[(Z)-hydrazinylidenemethyl]carbamimidothioate;hydrobromide has a molecular weight of 255.18 g/mol, XLogP of 1.31, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butyl N'-[(Z)-hydrazinylidenemethyl]carbamimidothioate;hydrobromide is sourced from PubChem (CID 173402410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).