C28H36N2O10S — CID 173411827
2-[2-[4-[acetyl(phenylmethoxy)amino]-4-(methoxymethyl)-1-(2-thiophen-2-ylethyl)piperidin-1-ium-1-yl]oxy-2-oxoethyl]-2,4-dihydroxy-4-oxobutanoate (PubChem CID 173411827) has the molecular formula C28H36N2O10S and a molecular weight of 592.67 g/mol. Its IUPAC name is 2-[2-[4-[acetyl(phenylmethoxy)amino]-4-(methoxymethyl)-1-(2-thiophen-2-ylethyl)piperidin-1-ium-1-yl]oxy-2-oxoethyl]-2,4-dihydroxy-4-oxobutanoate.
| Compound Name | 2-[2-[4-[acetyl(phenylmethoxy)amino]-4-(methoxymethyl)-1-(2-thiophen-2-ylethyl)piperidin-1-ium-1-yl]oxy-2-oxoethyl]-2,4-dihydroxy-4-oxobutanoate |
|---|---|
| PubChem CID | 173411827 |
| Molecular Formula | C28H36N2O10S |
| Molecular Weight | 592.67 g/mol |
| Exact Mass | 592.21 |
| IUPAC Name | 2-[2-[4-[acetyl(phenylmethoxy)amino]-4-(methoxymethyl)-1-(2-thiophen-2-ylethyl)piperidin-1-ium-1-yl]oxy-2-oxoethyl]-2,4-dihydroxy-4-oxobutanoate |
| SMILES | COCC1(N(OCc2ccccc2)C(C)=O)CC[N+](CCc2cccs2)(OC(=O)CC(O)(CC(=O)O)C(=O)[O-])CC1 |
| InChI | InChI=1S/C28H36N2O10S/c1-21(31)29(39-19-22-7-4-3-5-8-22)27(20-38-2)11-14-30(15-12-27,13-10-23-9-6-16-41-23)40-25(34)18-28(37,26(35)36)17-24(32)33/h3-9,16,37H,10-15,17-20H2,1-2H3,(H-,32,33,35,36) |
| InChIKey | QNOZWNCCZDETJV-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 162.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.67 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|