C30H38N2O10 — CID 173411890
2-[2-[4-[acetyl(phenylmethoxy)amino]-4-(methoxymethyl)-1-(2-phenylethyl)piperidin-1-ium-1-yl]oxy-2-oxoethyl]-2,4-dihydroxy-4-oxobutanoate (PubChem CID 173411890) has the molecular formula C30H38N2O10 and a molecular weight of 586.64 g/mol. Its IUPAC name is 2-[2-[4-[acetyl(phenylmethoxy)amino]-4-(methoxymethyl)-1-(2-phenylethyl)piperidin-1-ium-1-yl]oxy-2-oxoethyl]-2,4-dihydroxy-4-oxobutanoate.
| Compound Name | 2-[2-[4-[acetyl(phenylmethoxy)amino]-4-(methoxymethyl)-1-(2-phenylethyl)piperidin-1-ium-1-yl]oxy-2-oxoethyl]-2,4-dihydroxy-4-oxobutanoate |
|---|---|
| PubChem CID | 173411890 |
| Molecular Formula | C30H38N2O10 |
| Molecular Weight | 586.64 g/mol |
| Exact Mass | 586.25 |
| IUPAC Name | 2-[2-[4-[acetyl(phenylmethoxy)amino]-4-(methoxymethyl)-1-(2-phenylethyl)piperidin-1-ium-1-yl]oxy-2-oxoethyl]-2,4-dihydroxy-4-oxobutanoate |
| SMILES | COCC1(N(OCc2ccccc2)C(C)=O)CC[N+](CCc2ccccc2)(OC(=O)CC(O)(CC(=O)O)C(=O)[O-])CC1 |
| InChI | InChI=1S/C30H38N2O10/c1-23(33)31(41-21-25-11-7-4-8-12-25)29(22-40-2)14-17-32(18-15-29,16-13-24-9-5-3-6-10-24)42-27(36)20-30(39,28(37)38)19-26(34)35/h3-12,39H,13-22H2,1-2H3,(H-,34,35,37,38) |
| InChIKey | HZYXJWXVEXRIMY-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 162.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.64 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|