C44H64N12O12+2 — CID 57290494
bis[4-[acetyl(phenylmethoxy)amino]-1-[2-(4-ethyl-5-oxotetrazol-1-yl)ethyl]-4-(methoxymethyl)piperidin-1-ium-1-yl] oxalate (PubChem CID 57290494) has the molecular formula C44H64N12O12+2 and a molecular weight of 953.07 g/mol. Its IUPAC name is bis[4-[acetyl(phenylmethoxy)amino]-1-[2-(4-ethyl-5-oxotetrazol-1-yl)ethyl]-4-(methoxymethyl)piperidin-1-ium-1-yl] oxalate.
| Compound Name | bis[4-[acetyl(phenylmethoxy)amino]-1-[2-(4-ethyl-5-oxotetrazol-1-yl)ethyl]-4-(methoxymethyl)piperidin-1-ium-1-yl] oxalate |
|---|---|
| PubChem CID | 57290494 |
| Molecular Formula | C44H64N12O12+2 |
| Molecular Weight | 953.07 g/mol |
| Exact Mass | 952.48 |
| IUPAC Name | bis[4-[acetyl(phenylmethoxy)amino]-1-[2-(4-ethyl-5-oxotetrazol-1-yl)ethyl]-4-(methoxymethyl)piperidin-1-ium-1-yl] oxalate |
| SMILES | CCn1nnn(CC[N+]2(OC(=O)C(=O)O[N+]3(CCn4nnn(CC)c4=O)CCC(COC)(N(OCc4ccccc4)C(C)=O)CC3)CCC(COC)(N(OCc3ccccc3)C(C)=O)CC2)c1=O |
| InChI | InChI=1S/C44H64N12O12/c1-7-49-41(61)51(47-45-49)23-29-55(25-19-43(20-26-55,33-63-5)53(35(3)57)65-31-37-15-11-9-12-16-37)67-39(59)40(60)68-56(30-24-52-42(62)50(8-2)46-48-52)27-21-44(22-28-56,34-64-6)54(36(4)58)66-32-38-17-13-10-14-18-38/h9-18H,7-8,19-34H2,1-6H3/q+2 |
| InChIKey | QTHFKWORNYDAPN-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 235.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 953.07 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|