C21H40N2O3 — CID 173413394
19-(dimethylamino)-6,13-dihydroxynonadeca-7,11-dienamide (PubChem CID 173413394) has the molecular formula C21H40N2O3 and a molecular weight of 368.56 g/mol. Its IUPAC name is 19-(dimethylamino)-6,13-dihydroxynonadeca-7,11-dienamide.
| Compound Name | 19-(dimethylamino)-6,13-dihydroxynonadeca-7,11-dienamide |
|---|---|
| PubChem CID | 173413394 |
| Molecular Formula | C21H40N2O3 |
| Molecular Weight | 368.56 g/mol |
| Exact Mass | 368.30 |
| IUPAC Name | 19-(dimethylamino)-6,13-dihydroxynonadeca-7,11-dienamide |
| SMILES | CN(C)CCCCCCC(O)C=CCCC=CC(O)CCCCC(N)=O |
| InChI | InChI=1S/C21H40N2O3/c1-23(2)18-12-6-5-9-15-19(24)13-7-3-4-8-14-20(25)16-10-11-17-21(22)26/h7-8,13-14,19-20,24-25H,3-6,9-12,15-18H2,1-2H3,(H2,22,26) |
| InChIKey | WPOXSAKJBCSPLD-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.56 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|