C24H24N2O3SSe — CID 173434805
N-[2-(3-ethyl-1,3-benzoselenazol-3-ium-2-yl)ethenyl]aniline;2-methylbenzenesulfonate (PubChem CID 173434805) has the molecular formula C24H24N2O3SSe and a molecular weight of 499.49 g/mol. Its IUPAC name is N-[2-(3-ethyl-1,3-benzoselenazol-3-ium-2-yl)ethenyl]aniline;2-methylbenzenesulfonate.
| Compound Name | N-[2-(3-ethyl-1,3-benzoselenazol-3-ium-2-yl)ethenyl]aniline;2-methylbenzenesulfonate |
|---|---|
| PubChem CID | 173434805 |
| Molecular Formula | C24H24N2O3SSe |
| Molecular Weight | 499.49 g/mol |
| Exact Mass | 500.07 |
| IUPAC Name | N-[2-(3-ethyl-1,3-benzoselenazol-3-ium-2-yl)ethenyl]aniline;2-methylbenzenesulfonate |
| SMILES | CC[n+]1c(C=CNc2ccccc2)[se]c2ccccc21.Cc1ccccc1S(=O)(=O)[O-] |
| InChI | InChI=1S/C17H16N2Se.C7H8O3S/c1-2-19-15-10-6-7-11-16(15)20-17(19)12-13-18-14-8-4-3-5-9-14;1-6-4-2-3-5-7(6)11(8,9)10/h3-13H,2H2,1H3;2-5H,1H3,(H,8,9,10) |
| InChIKey | IUNAEUSQLHGTJU-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 73.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.49 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|