C78H142ClO12P — CID 173438757
chloro bis[19-(1,2-dihydroxyethyl)-18,20-dioxoheptatriaconta-9,28-dien-19-yl] phosphate (PubChem CID 173438757) has the molecular formula C78H142ClO12P and a molecular weight of 1338.41 g/mol. Its IUPAC name is chloro bis[19-(1,2-dihydroxyethyl)-18,20-dioxoheptatriaconta-9,28-dien-19-yl] phosphate.
| Compound Name | chloro bis[19-(1,2-dihydroxyethyl)-18,20-dioxoheptatriaconta-9,28-dien-19-yl] phosphate |
|---|---|
| PubChem CID | 173438757 |
| Molecular Formula | C78H142ClO12P |
| Molecular Weight | 1338.41 g/mol |
| Exact Mass | 1336.99 |
| IUPAC Name | chloro bis[19-(1,2-dihydroxyethyl)-18,20-dioxoheptatriaconta-9,28-dien-19-yl] phosphate |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)C(OP(=O)(OCl)OC(C(=O)CCCCCCCC=CCCCCCCCC)(C(=O)CCCCCCCC=CCCCCCCCC)C(O)CO)(C(=O)CCCCCCCC=CCCCCCCCC)C(O)CO |
| InChI | InChI=1S/C78H142ClO12P/c1-5-9-13-17-21-25-29-33-37-41-45-49-53-57-61-65-71(82)77(75(86)69-80,72(83)66-62-58-54-50-46-42-38-34-30-26-22-18-14-10-6-2)89-92(88,91-79)90-78(76(87)70-81,73(84)67-63-59-55-51-47-43-39-35-31-27-23-19-15-11-7-3)74(85)68-64-60-56-52-48-44-40-36-32-28-24-20-16-12-8-4/h33-40,75-76,80-81,86-87H,5-32,41-70H2,1-4H3 |
| InChIKey | QAZZTVJXNZFQPV-UHFFFAOYSA-N |
| XLogP | 22.91 |
| TPSA | 193.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 73 |
| Heavy Atoms | 92 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1338.41 |
| LogP ≤ 5 | 22.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|