C43H82NO8P — CID 91312885
2-aminoethyl [19-[(1S)-1,2-dihydroxyethyl]-18,20-dioxoheptatriaconta-9,28-dien-19-yl] ethyl phosphate (PubChem CID 91312885) has the molecular formula C43H82NO8P and a molecular weight of 772.10 g/mol. Its IUPAC name is 2-aminoethyl [19-[(1S)-1,2-dihydroxyethyl]-18,20-dioxoheptatriaconta-9,28-dien-19-yl] ethyl phosphate.
| Compound Name | 2-aminoethyl [19-[(1S)-1,2-dihydroxyethyl]-18,20-dioxoheptatriaconta-9,28-dien-19-yl] ethyl phosphate |
|---|---|
| PubChem CID | 91312885 |
| Molecular Formula | C43H82NO8P |
| Molecular Weight | 772.10 g/mol |
| Exact Mass | 771.58 |
| IUPAC Name | 2-aminoethyl [19-[(1S)-1,2-dihydroxyethyl]-18,20-dioxoheptatriaconta-9,28-dien-19-yl] ethyl phosphate |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)C(OP(=O)(OCC)OCCN)(C(=O)CCCCCCCC=CCCCCCCCC)[C@@H](O)CO |
| InChI | InChI=1S/C43H82NO8P/c1-4-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-40(46)43(42(48)39-45,52-53(49,50-6-3)51-38-37-44)41(47)36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-5-2/h19-22,42,45,48H,4-18,23-39,44H2,1-3H3/t42-,43?,53?/m0/s1 |
| InChIKey | DNRUJYPCTSYHHK-BUSSCGDYSA-N |
| XLogP | 11.43 |
| TPSA | 145.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.10 |
| LogP ≤ 5 | 11.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|