C18H18ClN5 — CID 173450185
8-chloro-N,3-dimethyl-6-phenyl-3a,4-dihydro-2H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-1-imine (PubChem CID 173450185) has the molecular formula C18H18ClN5 and a molecular weight of 339.83 g/mol. Its IUPAC name is 8-chloro-N,3-dimethyl-6-phenyl-3a,4-dihydro-2H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-1-imine.
| Compound Name | 8-chloro-N,3-dimethyl-6-phenyl-3a,4-dihydro-2H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-1-imine |
|---|---|
| PubChem CID | 173450185 |
| Molecular Formula | C18H18ClN5 |
| Molecular Weight | 339.83 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 8-chloro-N,3-dimethyl-6-phenyl-3a,4-dihydro-2H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-1-imine |
| SMILES | C/N=C1\NN(C)C2CN=C(c3ccccc3)c3cc(Cl)ccc3N12 |
| InChI | InChI=1S/C18H18ClN5/c1-20-18-22-23(2)16-11-21-17(12-6-4-3-5-7-12)14-10-13(19)8-9-15(14)24(16)18/h3-10,16H,11H2,1-2H3,(H,20,22) |
| InChIKey | DBIFRJBADPWNCQ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 43.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.83 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|