C18H20ClN5O3S — CID 173450263
N-(8-chloro-3-methyl-6-phenyl-3a,4-dihydro-2H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-1-ylidene)methanesulfonamide;hydrate (PubChem CID 173450263) has the molecular formula C18H20ClN5O3S and a molecular weight of 421.91 g/mol. Its IUPAC name is N-(8-chloro-3-methyl-6-phenyl-3a,4-dihydro-2H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-1-ylidene)methanesulfonamide;hydrate.
| Compound Name | N-(8-chloro-3-methyl-6-phenyl-3a,4-dihydro-2H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-1-ylidene)methanesulfonamide;hydrate |
|---|---|
| PubChem CID | 173450263 |
| Molecular Formula | C18H20ClN5O3S |
| Molecular Weight | 421.91 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | N-(8-chloro-3-methyl-6-phenyl-3a,4-dihydro-2H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-1-ylidene)methanesulfonamide;hydrate |
| SMILES | CN1NC(=NS(C)(=O)=O)N2c3ccc(Cl)cc3C(c3ccccc3)=NCC12.O |
| InChI | InChI=1S/C18H18ClN5O2S.H2O/c1-23-16-11-20-17(12-6-4-3-5-7-12)14-10-13(19)8-9-15(14)24(16)18(21-23)22-27(2,25)26;/h3-10,16H,11H2,1-2H3,(H,21,22);1H2 |
| InChIKey | WSWXEVYUULUBSD-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 108.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.91 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|