C12H28BFN2O2S4 — CID 173456378
fluoroboronic acid;bis(2-methyl-2-methylsulfanyl-1,3-thiazinane) (PubChem CID 173456378) has the molecular formula C12H28BFN2O2S4 and a molecular weight of 390.45 g/mol. Its IUPAC name is fluoroboronic acid;bis(2-methyl-2-methylsulfanyl-1,3-thiazinane).
| Compound Name | fluoroboronic acid;bis(2-methyl-2-methylsulfanyl-1,3-thiazinane) |
|---|---|
| PubChem CID | 173456378 |
| Molecular Formula | C12H28BFN2O2S4 |
| Molecular Weight | 390.45 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | fluoroboronic acid;bis(2-methyl-2-methylsulfanyl-1,3-thiazinane) |
| SMILES | CSC1(C)NCCCS1.CSC1(C)NCCCS1.OB(O)F |
| InChI | InChI=1S/2C6H13NS2.BFH2O2/c2*1-6(8-2)7-4-3-5-9-6;2-1(3)4/h2*7H,3-5H2,1-2H3;3-4H |
| InChIKey | QYHZQPWQDFJREJ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.45 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|