C21H22N3NaO4 — CID 173461960
sodium;hydride;1-[[2-hydroxy-5-(2-methylbutan-2-yl)-3-nitrophenyl]diazenyl]naphthalen-2-ol (PubChem CID 173461960) has the molecular formula C21H22N3NaO4 and a molecular weight of 403.41 g/mol. Its IUPAC name is sodium;hydride;1-[[2-hydroxy-5-(2-methylbutan-2-yl)-3-nitrophenyl]diazenyl]naphthalen-2-ol.
| Compound Name | sodium;hydride;1-[[2-hydroxy-5-(2-methylbutan-2-yl)-3-nitrophenyl]diazenyl]naphthalen-2-ol |
|---|---|
| PubChem CID | 173461960 |
| Molecular Formula | C21H22N3NaO4 |
| Molecular Weight | 403.41 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | sodium;hydride;1-[[2-hydroxy-5-(2-methylbutan-2-yl)-3-nitrophenyl]diazenyl]naphthalen-2-ol |
| SMILES | CCC(C)(C)c1cc(/N=N/c2c(O)ccc3ccccc23)c(O)c([N+](=O)[O-])c1.[H-].[Na+] |
| InChI | InChI=1S/C21H21N3O4.Na.H/c1-4-21(2,3)14-11-16(20(26)17(12-14)24(27)28)22-23-19-15-8-6-5-7-13(15)9-10-18(19)25;;/h5-12,25-26H,4H2,1-3H3;;/q;+1;-1/b23-22+;; |
| InChIKey | WAJZYXLPUDRXGS-VPMNAVQSSA-N |
| XLogP | 3.38 |
| TPSA | 108.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.41 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|