About sodium;hydride;sulfanyl 5-cyanopentane-1-sulfonate
sodium;hydride;sulfanyl 5-cyanopentane-1-sulfonate (PubChem CID 173462636) has the molecular formula C6H12NNaO3S2
and a molecular weight of 233.29 g/mol. Its IUPAC name is sodium;hydride;sulfanyl 5-cyanopentane-1-sulfonate.
Molecular Properties
| Compound Name | sodium;hydride;sulfanyl 5-cyanopentane-1-sulfonate |
| PubChem CID | 173462636 |
| Molecular Formula | C6H12NNaO3S2 |
| Molecular Weight | 233.29 g/mol |
| Exact Mass | 233.02 |
| IUPAC Name | sodium;hydride;sulfanyl 5-cyanopentane-1-sulfonate |
| SMILES | N#CCCCCCS(=O)(=O)OS.[H-].[Na+] |
| InChI | InChI=1S/C6H11NO3S2.Na.H/c7-5-3-1-2-4-6-12(8,9)10-11;;/h11H,1-4,6H2;;/q;+1;-1 |
| InChIKey | UULCYUNXEQOPHR-UHFFFAOYSA-N |
| XLogP | -1.62 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.29 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;sulfanyl 5-cyanopentane-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;sulfanyl 5-cyanopentane-1-sulfonate?
The IUPAC name of sodium;hydride;sulfanyl 5-cyanopentane-1-sulfonate (CID 173462636) is sodium;hydride;sulfanyl 5-cyanopentane-1-sulfonate.
What is the SMILES notation for sodium;hydride;sulfanyl 5-cyanopentane-1-sulfonate?
The canonical SMILES for sodium;hydride;sulfanyl 5-cyanopentane-1-sulfonate is N#CCCCCCS(=O)(=O)OS.[H-].[Na+].
What is the InChIKey of sodium;hydride;sulfanyl 5-cyanopentane-1-sulfonate?
The InChIKey is UULCYUNXEQOPHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO3S2.Na.H/c7-5-3-1-2-4-6-12(8,9)10-11;;/h11H,1-4,6H2;;/q;+1;-1.
What are the key properties of sodium;hydride;sulfanyl 5-cyanopentane-1-sulfonate?
sodium;hydride;sulfanyl 5-cyanopentane-1-sulfonate has a molecular weight of 233.29 g/mol, XLogP of -1.62, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;sulfanyl 5-cyanopentane-1-sulfonate is sourced from PubChem (CID 173462636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).