C4H9FO6S3 — CID 140616680
1-O-fluoro 4-O-sulfanyl butane-1,4-disulfonate (PubChem CID 140616680) has the molecular formula C4H9FO6S3 and a molecular weight of 268.31 g/mol. Its IUPAC name is 1-O-fluoro 4-O-sulfanyl butane-1,4-disulfonate.
| Compound Name | 1-O-fluoro 4-O-sulfanyl butane-1,4-disulfonate |
|---|---|
| PubChem CID | 140616680 |
| Molecular Formula | C4H9FO6S3 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 267.95 |
| IUPAC Name | 1-O-fluoro 4-O-sulfanyl butane-1,4-disulfonate |
| SMILES | O=S(=O)(CCCCS(=O)(=O)OS)OF |
| InChI | InChI=1S/C4H9FO6S3/c5-10-13(6,7)3-1-2-4-14(8,9)11-12/h12H,1-4H2 |
| InChIKey | CDNXCLINKOEHQE-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 86.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|