C20H26O3S — CID 173465715
[(3Z)-4-methylidene-3-[(Z)-3-methylpent-2-enylidene]cyclohexyl] 4-methylbenzenesulfonate (PubChem CID 173465715) has the molecular formula C20H26O3S and a molecular weight of 346.49 g/mol. Its IUPAC name is [(3Z)-4-methylidene-3-[(Z)-3-methylpent-2-enylidene]cyclohexyl] 4-methylbenzenesulfonate.
| Compound Name | [(3Z)-4-methylidene-3-[(Z)-3-methylpent-2-enylidene]cyclohexyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 173465715 |
| Molecular Formula | C20H26O3S |
| Molecular Weight | 346.49 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | [(3Z)-4-methylidene-3-[(Z)-3-methylpent-2-enylidene]cyclohexyl] 4-methylbenzenesulfonate |
| SMILES | C=C1CCC(OS(=O)(=O)c2ccc(C)cc2)C/C1=C/C=C(/C)CC |
| InChI | InChI=1S/C20H26O3S/c1-5-15(2)6-10-18-14-19(11-9-17(18)4)23-24(21,22)20-12-7-16(3)8-13-20/h6-8,10,12-13,19H,4-5,9,11,14H2,1-3H3/b15-6-,18-10- |
| InChIKey | LWSMOSMYYHUAMY-ZLYRREDLSA-N |
| XLogP | 5.09 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.49 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|