C21H48Cl2N2O — CID 173469879
2-hexadecan-2-yloxy-3-methylbutane-1,1-diamine;dihydrochloride (PubChem CID 173469879) has the molecular formula C21H48Cl2N2O and a molecular weight of 415.53 g/mol. Its IUPAC name is 2-hexadecan-2-yloxy-3-methylbutane-1,1-diamine;dihydrochloride.
| Compound Name | 2-hexadecan-2-yloxy-3-methylbutane-1,1-diamine;dihydrochloride |
|---|---|
| PubChem CID | 173469879 |
| Molecular Formula | C21H48Cl2N2O |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 414.31 |
| IUPAC Name | 2-hexadecan-2-yloxy-3-methylbutane-1,1-diamine;dihydrochloride |
| SMILES | CCCCCCCCCCCCCCC(C)OC(C(C)C)C(N)N.Cl.Cl |
| InChI | InChI=1S/C21H46N2O.2ClH/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-19(4)24-20(18(2)3)21(22)23;;/h18-21H,5-17,22-23H2,1-4H3;2*1H |
| InChIKey | VOSKYYSWESKLPZ-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|