About 3-decyltridecan-2-amine;hydrochloride
3-decyltridecan-2-amine;hydrochloride (PubChem CID 173130271) has the molecular formula C23H50ClN
and a molecular weight of 376.11 g/mol. Its IUPAC name is 3-decyltridecan-2-amine;hydrochloride.
Molecular Properties
| Compound Name | 3-decyltridecan-2-amine;hydrochloride |
| PubChem CID | 173130271 |
| Molecular Formula | C23H50ClN |
| Molecular Weight | 376.11 g/mol |
| Exact Mass | 375.36 |
| IUPAC Name | 3-decyltridecan-2-amine;hydrochloride |
| SMILES | CCCCCCCCCCC(CCCCCCCCCC)C(C)N.Cl |
| InChI | InChI=1S/C23H49N.ClH/c1-4-6-8-10-12-14-16-18-20-23(22(3)24)21-19-17-15-13-11-9-7-5-2;/h22-23H,4-21,24H2,1-3H3;1H |
| InChIKey | BMUBQGFCWARLOL-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 376.11 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-decyltridecan-2-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-decyltridecan-2-amine;hydrochloride?
The IUPAC name of 3-decyltridecan-2-amine;hydrochloride (CID 173130271) is 3-decyltridecan-2-amine;hydrochloride.
What is the SMILES notation for 3-decyltridecan-2-amine;hydrochloride?
The canonical SMILES for 3-decyltridecan-2-amine;hydrochloride is CCCCCCCCCCC(CCCCCCCCCC)C(C)N.Cl.
What is the InChIKey of 3-decyltridecan-2-amine;hydrochloride?
The InChIKey is BMUBQGFCWARLOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H49N.ClH/c1-4-6-8-10-12-14-16-18-20-23(22(3)24)21-19-17-15-13-11-9-7-5-2;/h22-23H,4-21,24H2,1-3H3;1H.
What are the key properties of 3-decyltridecan-2-amine;hydrochloride?
3-decyltridecan-2-amine;hydrochloride has a molecular weight of 376.11 g/mol, XLogP of 8.43, 19 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-decyltridecan-2-amine;hydrochloride is sourced from PubChem (CID 173130271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).