C17H21FINO4 — CID 173476314
1-(2-fluoro-5-iodo-4-methoxyphenyl)-3-hydroxy-2-[[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]iminomethyl]prop-2-en-1-one (PubChem CID 173476314) has the molecular formula C17H21FINO4 and a molecular weight of 449.26 g/mol. Its IUPAC name is 1-(2-fluoro-5-iodo-4-methoxyphenyl)-3-hydroxy-2-[[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]iminomethyl]prop-2-en-1-one.
| Compound Name | 1-(2-fluoro-5-iodo-4-methoxyphenyl)-3-hydroxy-2-[[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]iminomethyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 173476314 |
| Molecular Formula | C17H21FINO4 |
| Molecular Weight | 449.26 g/mol |
| Exact Mass | 449.05 |
| IUPAC Name | 1-(2-fluoro-5-iodo-4-methoxyphenyl)-3-hydroxy-2-[[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]iminomethyl]prop-2-en-1-one |
| SMILES | COc1cc(F)c(C(=O)C(=CO)/C=N/[C@H](CO)C(C)(C)C)cc1I |
| InChI | InChI=1S/C17H21FINO4/c1-17(2,3)15(9-22)20-7-10(8-21)16(23)11-5-13(19)14(24-4)6-12(11)18/h5-8,15,21-22H,9H2,1-4H3/b10-8?,20-7+/t15-/m1/s1 |
| InChIKey | JABWLQCXENIFEO-IQTPRURVSA-N |
| XLogP | 3.54 |
| TPSA | 79.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.26 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|