C27H12Cl8N2O4 — CID 173486967
4,5,6,7-tetrachloro-2-[2-[1-hydroxy-1-[2,3,4,5-tetrachloro-6-(hydroxymethyl)phenyl]prop-1-en-2-yl]quinolin-8-yl]isoindole-1,3-dione (PubChem CID 173486967) has the molecular formula C27H12Cl8N2O4 and a molecular weight of 712.03 g/mol. Its IUPAC name is 4,5,6,7-tetrachloro-2-[2-[1-hydroxy-1-[2,3,4,5-tetrachloro-6-(hydroxymethyl)phenyl]prop-1-en-2-yl]quinolin-8-yl]isoindole-1,3-dione.
| Compound Name | 4,5,6,7-tetrachloro-2-[2-[1-hydroxy-1-[2,3,4,5-tetrachloro-6-(hydroxymethyl)phenyl]prop-1-en-2-yl]quinolin-8-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 173486967 |
| Molecular Formula | C27H12Cl8N2O4 |
| Molecular Weight | 712.03 g/mol |
| Exact Mass | 707.83 |
| IUPAC Name | 4,5,6,7-tetrachloro-2-[2-[1-hydroxy-1-[2,3,4,5-tetrachloro-6-(hydroxymethyl)phenyl]prop-1-en-2-yl]quinolin-8-yl]isoindole-1,3-dione |
| SMILES | CC(=C(O)c1c(Cl)c(Cl)c(Cl)c(Cl)c1CO)c1ccc2cccc(N3C(=O)c4c(Cl)c(Cl)c(Cl)c(Cl)c4C3=O)c2n1 |
| InChI | InChI=1S/C27H12Cl8N2O4/c1-8(25(39)13-10(7-38)16(28)20(32)21(33)17(13)29)11-6-5-9-3-2-4-12(24(9)36-11)37-26(40)14-15(27(37)41)19(31)23(35)22(34)18(14)30/h2-6,38-39H,7H2,1H3 |
| InChIKey | HIQCBHUHJNWDNW-UHFFFAOYSA-N |
| XLogP | 10.20 |
| TPSA | 90.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.03 |
| LogP ≤ 5 | 10.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|