C11H15N9O5 — CID 173492772
5-amino-3-[(2R,3R,4S,5S)-5-(azidomethyl)-5-ethoxy-3,4-dihydroxyoxolan-2-yl]-6H-triazolo[4,5-d]pyrimidin-7-one (PubChem CID 173492772) has the molecular formula C11H15N9O5 and a molecular weight of 353.30 g/mol. Its IUPAC name is 5-amino-3-[(2R,3R,4S,5S)-5-(azidomethyl)-5-ethoxy-3,4-dihydroxyoxolan-2-yl]-6H-triazolo[4,5-d]pyrimidin-7-one.
| Compound Name | 5-amino-3-[(2R,3R,4S,5S)-5-(azidomethyl)-5-ethoxy-3,4-dihydroxyoxolan-2-yl]-6H-triazolo[4,5-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 173492772 |
| Molecular Formula | C11H15N9O5 |
| Molecular Weight | 353.30 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | 5-amino-3-[(2R,3R,4S,5S)-5-(azidomethyl)-5-ethoxy-3,4-dihydroxyoxolan-2-yl]-6H-triazolo[4,5-d]pyrimidin-7-one |
| SMILES | CCO[C@@]1(CN=[N+]=[N-])O[C@@H](n2nnc3c(=O)[nH]c(N)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C11H15N9O5/c1-2-24-11(3-14-18-13)6(22)5(21)9(25-11)20-7-4(17-19-20)8(23)16-10(12)15-7/h5-6,9,21-22H,2-3H2,1H3,(H3,12,15,16,23)/t5-,6+,9-,11+/m1/s1 |
| InChIKey | TXTCWAJRPQOXFT-JUQFDLSGSA-N |
| XLogP | -1.61 |
| TPSA | 210.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.30 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|