C10H25N5O3 — CID 173493038
[3-[2-[bis(2-aminoethyl)amino]ethylamino]-3-hydroxypropyl]carbamic acid (PubChem CID 173493038) has the molecular formula C10H25N5O3 and a molecular weight of 263.34 g/mol. Its IUPAC name is [3-[2-[bis(2-aminoethyl)amino]ethylamino]-3-hydroxypropyl]carbamic acid.
| Compound Name | [3-[2-[bis(2-aminoethyl)amino]ethylamino]-3-hydroxypropyl]carbamic acid |
|---|---|
| PubChem CID | 173493038 |
| Molecular Formula | C10H25N5O3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.20 |
| IUPAC Name | [3-[2-[bis(2-aminoethyl)amino]ethylamino]-3-hydroxypropyl]carbamic acid |
| SMILES | NCCN(CCN)CCNC(O)CCNC(=O)O |
| InChI | InChI=1S/C10H25N5O3/c11-2-6-15(7-3-12)8-5-13-9(16)1-4-14-10(17)18/h9,13-14,16H,1-8,11-12H2,(H,17,18) |
| InChIKey | XXKFKADZRISCRF-UHFFFAOYSA-N |
| XLogP | -2.23 |
| TPSA | 136.87 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | -2.23 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|