About 2-amino-N-(2-aminoethyl)propanamide;rutherfordium
2-amino-N-(2-aminoethyl)propanamide;rutherfordium (PubChem CID 173496992) has the molecular formula C5H12N3ORf-
and a molecular weight of 397.17 g/mol. Its IUPAC name is 2-amino-N-(2-aminoethyl)propanamide;rutherfordium.
Molecular Properties
| Compound Name | 2-amino-N-(2-aminoethyl)propanamide;rutherfordium |
| PubChem CID | 173496992 |
| Molecular Formula | C5H12N3ORf- |
| Molecular Weight | 397.17 g/mol |
| Exact Mass | 397.22 |
| IUPAC Name | 2-amino-N-(2-aminoethyl)propanamide;rutherfordium |
| SMILES | [CH2-]C(N)C(=O)NCCN.[Rf] |
| InChI | InChI=1S/C5H12N3O.Rf/c1-4(7)5(9)8-3-2-6;/h4H,1-3,6-7H2,(H,8,9);/q-1; |
| InChIKey | CIXPWOLTYDIMHN-UHFFFAOYSA-N |
| XLogP | -1.78 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.17 |
| LogP ≤ 5 | -1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-N-(2-aminoethyl)propanamide;rutherfordium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N-(2-aminoethyl)propanamide;rutherfordium?
The IUPAC name of 2-amino-N-(2-aminoethyl)propanamide;rutherfordium (CID 173496992) is 2-amino-N-(2-aminoethyl)propanamide;rutherfordium.
What is the SMILES notation for 2-amino-N-(2-aminoethyl)propanamide;rutherfordium?
The canonical SMILES for 2-amino-N-(2-aminoethyl)propanamide;rutherfordium is [CH2-]C(N)C(=O)NCCN.[Rf].
What is the InChIKey of 2-amino-N-(2-aminoethyl)propanamide;rutherfordium?
The InChIKey is CIXPWOLTYDIMHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N3O.Rf/c1-4(7)5(9)8-3-2-6;/h4H,1-3,6-7H2,(H,8,9);/q-1;.
What are the key properties of 2-amino-N-(2-aminoethyl)propanamide;rutherfordium?
2-amino-N-(2-aminoethyl)propanamide;rutherfordium has a molecular weight of 397.17 g/mol, XLogP of -1.78, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N-(2-aminoethyl)propanamide;rutherfordium is sourced from PubChem (CID 173496992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).