C21H24O — CID 173497547
4-methoxy-2-methyl-1-[(2Z)-4-(3-methylphenyl)hexa-2,4-dien-2-yl]benzene (PubChem CID 173497547) has the molecular formula C21H24O and a molecular weight of 292.42 g/mol. Its IUPAC name is 4-methoxy-2-methyl-1-[(2Z)-4-(3-methylphenyl)hexa-2,4-dien-2-yl]benzene.
| Compound Name | 4-methoxy-2-methyl-1-[(2Z)-4-(3-methylphenyl)hexa-2,4-dien-2-yl]benzene |
|---|---|
| PubChem CID | 173497547 |
| Molecular Formula | C21H24O |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | 4-methoxy-2-methyl-1-[(2Z)-4-(3-methylphenyl)hexa-2,4-dien-2-yl]benzene |
| SMILES | CC=C(/C=C(/C)c1ccc(OC)cc1C)c1cccc(C)c1 |
| InChI | InChI=1S/C21H24O/c1-6-18(19-9-7-8-15(2)12-19)13-16(3)21-11-10-20(22-5)14-17(21)4/h6-14H,1-5H3/b16-13-,18-6? |
| InChIKey | HUYFHQFNVKCLFT-QNBTVRQASA-N |
| XLogP | 5.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|