C17H21N3O2 — CID 173499178
N'-[2-[(Z)-1-aminobut-1-en-2-yl]-4-methyl-3-oxopenta-1,4-dienyl]benzohydrazide (PubChem CID 173499178) has the molecular formula C17H21N3O2 and a molecular weight of 299.37 g/mol. Its IUPAC name is N'-[2-[(Z)-1-aminobut-1-en-2-yl]-4-methyl-3-oxopenta-1,4-dienyl]benzohydrazide.
| Compound Name | N'-[2-[(Z)-1-aminobut-1-en-2-yl]-4-methyl-3-oxopenta-1,4-dienyl]benzohydrazide |
|---|---|
| PubChem CID | 173499178 |
| Molecular Formula | C17H21N3O2 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | N'-[2-[(Z)-1-aminobut-1-en-2-yl]-4-methyl-3-oxopenta-1,4-dienyl]benzohydrazide |
| SMILES | C=C(C)C(=O)C(=CNNC(=O)c1ccccc1)/C(=C\N)CC |
| InChI | InChI=1S/C17H21N3O2/c1-4-13(10-18)15(16(21)12(2)3)11-19-20-17(22)14-8-6-5-7-9-14/h5-11,19H,2,4,18H2,1,3H3,(H,20,22)/b13-10-,15-11? |
| InChIKey | MHNCJGALWKUSJS-WSAYOVPUSA-N |
| XLogP | 2.20 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|