C16H18ClN5O2 — CID 17395771
7-[2-(3-chloro-2-methylanilino)ethyl]-1,3-dimethylpurine-2,6-dione (PubChem CID 17395771) has the molecular formula C16H18ClN5O2 and a molecular weight of 347.81 g/mol. Its IUPAC name is 7-[2-(3-chloro-2-methylanilino)ethyl]-1,3-dimethylpurine-2,6-dione.
| Compound Name | 7-[2-(3-chloro-2-methylanilino)ethyl]-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 17395771 |
| Molecular Formula | C16H18ClN5O2 |
| Molecular Weight | 347.81 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | 7-[2-(3-chloro-2-methylanilino)ethyl]-1,3-dimethylpurine-2,6-dione |
| SMILES | Cc1c(Cl)cccc1NCCn1cnc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C16H18ClN5O2/c1-10-11(17)5-4-6-12(10)18-7-8-22-9-19-14-13(22)15(23)21(3)16(24)20(14)2/h4-6,9,18H,7-8H2,1-3H3 |
| InChIKey | ZDLRVXPINGQZNA-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 73.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.81 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |