C16H25N6O2+ — CID 6924214
1,3-dimethyl-7-[2-[(1-methyl-3,4,5,6-tetrahydro-2H-azepin-1-ium-7-yl)amino]ethyl]purine-2,6-dione (PubChem CID 6924214) has the molecular formula C16H25N6O2+ and a molecular weight of 333.42 g/mol. Its IUPAC name is 1,3-dimethyl-7-[2-[(1-methyl-3,4,5,6-tetrahydro-2H-azepin-1-ium-7-yl)amino]ethyl]purine-2,6-dione.
| Compound Name | 1,3-dimethyl-7-[2-[(1-methyl-3,4,5,6-tetrahydro-2H-azepin-1-ium-7-yl)amino]ethyl]purine-2,6-dione |
|---|---|
| PubChem CID | 6924214 |
| Molecular Formula | C16H25N6O2+ |
| Molecular Weight | 333.42 g/mol |
| Exact Mass | 333.20 |
| IUPAC Name | 1,3-dimethyl-7-[2-[(1-methyl-3,4,5,6-tetrahydro-2H-azepin-1-ium-7-yl)amino]ethyl]purine-2,6-dione |
| SMILES | Cn1c(=O)c2c(ncn2CCNC2=[N+](C)CCCCC2)n(C)c1=O |
| InChI | InChI=1S/C16H24N6O2/c1-19-9-6-4-5-7-12(19)17-8-10-22-11-18-14-13(22)15(23)21(3)16(24)20(14)2/h11H,4-10H2,1-3H3/p+1 |
| InChIKey | UHFALZIVWOPQHL-UHFFFAOYSA-O |
| XLogP | -0.36 |
| TPSA | 76.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.42 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|