C28H43BN4O6 — CID 174000662
[(1R)-1-[2-[but-3-en-2-yl-[2-cyano-2,4-dimethyl-4-[(2R)-2-methylmorpholin-4-yl]pentanoyl]amino]ethoxycarbonylamino]-2-phenylethyl]boronic acid (PubChem CID 174000662) has the molecular formula C28H43BN4O6 and a molecular weight of 542.49 g/mol. Its IUPAC name is [(1R)-1-[2-[but-3-en-2-yl-[2-cyano-2,4-dimethyl-4-[(2R)-2-methylmorpholin-4-yl]pentanoyl]amino]ethoxycarbonylamino]-2-phenylethyl]boronic acid.
| Compound Name | [(1R)-1-[2-[but-3-en-2-yl-[2-cyano-2,4-dimethyl-4-[(2R)-2-methylmorpholin-4-yl]pentanoyl]amino]ethoxycarbonylamino]-2-phenylethyl]boronic acid |
|---|---|
| PubChem CID | 174000662 |
| Molecular Formula | C28H43BN4O6 |
| Molecular Weight | 542.49 g/mol |
| Exact Mass | 542.33 |
| IUPAC Name | [(1R)-1-[2-[but-3-en-2-yl-[2-cyano-2,4-dimethyl-4-[(2R)-2-methylmorpholin-4-yl]pentanoyl]amino]ethoxycarbonylamino]-2-phenylethyl]boronic acid |
| SMILES | C=CC(C)N(CCOC(=O)N[C@@H](Cc1ccccc1)B(O)O)C(=O)C(C)(C#N)CC(C)(C)N1CCO[C@H](C)C1 |
| InChI | InChI=1S/C28H43BN4O6/c1-7-21(2)33(14-16-39-26(35)31-24(29(36)37)17-23-11-9-8-10-12-23)25(34)28(6,20-30)19-27(4,5)32-13-15-38-22(3)18-32/h7-12,21-22,24,36-37H,1,13-19H2,2-6H3,(H,31,35)/t21?,22-,24+,28?/m1/s1 |
| InChIKey | ZSNQCZXUMRSEFX-UWLKXGSZSA-N |
| XLogP | 2.16 |
| TPSA | 135.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.49 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|