C8H14F2O2 — CID 174023896
(2S,3S,4S)-4-fluoro-2-(1-fluoroethenyl)-3-methylpentane-1,1-diol (PubChem CID 174023896) has the molecular formula C8H14F2O2 and a molecular weight of 180.19 g/mol. Its IUPAC name is (2S,3S,4S)-4-fluoro-2-(1-fluoroethenyl)-3-methylpentane-1,1-diol.
| Compound Name | (2S,3S,4S)-4-fluoro-2-(1-fluoroethenyl)-3-methylpentane-1,1-diol |
|---|---|
| PubChem CID | 174023896 |
| Molecular Formula | C8H14F2O2 |
| Molecular Weight | 180.19 g/mol |
| Exact Mass | 180.10 |
| IUPAC Name | (2S,3S,4S)-4-fluoro-2-(1-fluoroethenyl)-3-methylpentane-1,1-diol |
| SMILES | C=C(F)[C@H](C(O)O)[C@H](C)[C@H](C)F |
| InChI | InChI=1S/C8H14F2O2/c1-4(5(2)9)7(6(3)10)8(11)12/h4-5,7-8,11-12H,3H2,1-2H3/t4-,5+,7-/m1/s1 |
| InChIKey | HMZQKWUJVQCVTJ-JCGDXUMPSA-N |
| XLogP | 1.39 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.19 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|