C13H23F2N2OP — CID 174024419
N'-[(3E,7Z)-4-difluorophosphanyloxynona-1,3,7-trien-2-yl]butane-1,4-diamine (PubChem CID 174024419) has the molecular formula C13H23F2N2OP and a molecular weight of 292.31 g/mol. Its IUPAC name is N'-[(3E,7Z)-4-difluorophosphanyloxynona-1,3,7-trien-2-yl]butane-1,4-diamine.
| Compound Name | N'-[(3E,7Z)-4-difluorophosphanyloxynona-1,3,7-trien-2-yl]butane-1,4-diamine |
|---|---|
| PubChem CID | 174024419 |
| Molecular Formula | C13H23F2N2OP |
| Molecular Weight | 292.31 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | N'-[(3E,7Z)-4-difluorophosphanyloxynona-1,3,7-trien-2-yl]butane-1,4-diamine |
| SMILES | C=C(/C=C(\CC/C=C\C)OP(F)F)NCCCCN |
| InChI | InChI=1S/C13H23F2N2OP/c1-3-4-5-8-13(18-19(14)15)11-12(2)17-10-7-6-9-16/h3-4,11,17H,2,5-10,16H2,1H3/b4-3-,13-11+ |
| InChIKey | QDTQAPQGKZUQDY-KBCNIFDOSA-N |
| XLogP | 4.25 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.31 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|