C17H29N3 — CID 174025411
(6Z,8E)-5-methyl-6-(methylaminomethyl)-3-methylidene-4-pentyl-1,2-dihydroazonin-8-amine (PubChem CID 174025411) has the molecular formula C17H29N3 and a molecular weight of 275.44 g/mol. Its IUPAC name is (6Z,8E)-5-methyl-6-(methylaminomethyl)-3-methylidene-4-pentyl-1,2-dihydroazonin-8-amine.
| Compound Name | (6Z,8E)-5-methyl-6-(methylaminomethyl)-3-methylidene-4-pentyl-1,2-dihydroazonin-8-amine |
|---|---|
| PubChem CID | 174025411 |
| Molecular Formula | C17H29N3 |
| Molecular Weight | 275.44 g/mol |
| Exact Mass | 275.24 |
| IUPAC Name | (6Z,8E)-5-methyl-6-(methylaminomethyl)-3-methylidene-4-pentyl-1,2-dihydroazonin-8-amine |
| SMILES | C=C1CN/C=C(N)\C=C(/CNC)C(C)=C1CCCCC |
| InChI | InChI=1S/C17H29N3/c1-5-6-7-8-17-13(2)10-20-12-16(18)9-15(11-19-4)14(17)3/h9,12,19-20H,2,5-8,10-11,18H2,1,3-4H3/b15-9+,16-12+,17-14? |
| InChIKey | HGWPWFPTKUJWDR-IIFPWPJPSA-N |
| XLogP | 2.99 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.44 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|