C18H26Cl2FN — CID 174028338
(Z,3E)-3-[(Z)-4-chloro-3-fluoropent-3-en-2-ylidene]-N-[(Z)-1-chloropent-1-enyl]oct-4-en-2-imine (PubChem CID 174028338) has the molecular formula C18H26Cl2FN and a molecular weight of 346.32 g/mol. Its IUPAC name is (Z,3E)-3-[(Z)-4-chloro-3-fluoropent-3-en-2-ylidene]-N-[(Z)-1-chloropent-1-enyl]oct-4-en-2-imine.
| Compound Name | (Z,3E)-3-[(Z)-4-chloro-3-fluoropent-3-en-2-ylidene]-N-[(Z)-1-chloropent-1-enyl]oct-4-en-2-imine |
|---|---|
| PubChem CID | 174028338 |
| Molecular Formula | C18H26Cl2FN |
| Molecular Weight | 346.32 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | (Z,3E)-3-[(Z)-4-chloro-3-fluoropent-3-en-2-ylidene]-N-[(Z)-1-chloropent-1-enyl]oct-4-en-2-imine |
| SMILES | CCC/C=C\C(C(C)=N/C(Cl)=C/CCC)=C(C)/C(F)=C(\C)Cl |
| InChI | InChI=1S/C18H26Cl2FN/c1-6-8-10-11-16(13(3)18(21)14(4)19)15(5)22-17(20)12-9-7-2/h10-12H,6-9H2,1-5H3/b11-10-,16-13+,17-12+,18-14-,22-15? |
| InChIKey | AVBIQOMFKOLABR-NLKMMWPXSA-N |
| XLogP | 7.44 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.32 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|