C19H35N — CID 174032059
3-(2,2-dimethylpropyl)-N-methyl-N-[(6E)-6-methylocta-1,6-dien-2-yl]cyclobutan-1-amine (PubChem CID 174032059) has the molecular formula C19H35N and a molecular weight of 277.50 g/mol. Its IUPAC name is 3-(2,2-dimethylpropyl)-N-methyl-N-[(6E)-6-methylocta-1,6-dien-2-yl]cyclobutan-1-amine.
| Compound Name | 3-(2,2-dimethylpropyl)-N-methyl-N-[(6E)-6-methylocta-1,6-dien-2-yl]cyclobutan-1-amine |
|---|---|
| PubChem CID | 174032059 |
| Molecular Formula | C19H35N |
| Molecular Weight | 277.50 g/mol |
| Exact Mass | 277.28 |
| IUPAC Name | 3-(2,2-dimethylpropyl)-N-methyl-N-[(6E)-6-methylocta-1,6-dien-2-yl]cyclobutan-1-amine |
| SMILES | C=C(CCC/C(C)=C/C)N(C)C1CC(CC(C)(C)C)C1 |
| InChI | InChI=1S/C19H35N/c1-8-15(2)10-9-11-16(3)20(7)18-12-17(13-18)14-19(4,5)6/h8,17-18H,3,9-14H2,1-2,4-7H3/b15-8+ |
| InChIKey | CICIMZAAUQJXSI-OVCLIPMQSA-N |
| XLogP | 5.78 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.50 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|