C12H7B10NO2 — CID 174064800
CID 174064800 (PubChem CID 174064800) has the molecular formula C12H7B10NO2 and a molecular weight of 305.31 g/mol.
| Compound Name | CID 174064800 |
|---|---|
| PubChem CID | 174064800 |
| Molecular Formula | C12H7B10NO2 |
| Molecular Weight | 305.31 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | — |
| SMILES | [B]C([B])([B])NC([B])(C([B])([B])C)C([B])([B])c1ccc2c(c1)OC([B])([B])O2 |
| InChI | InChI=1S/C12H7B10NO2/c1-8(13,14)10(17,23-11(18,19)20)9(15,16)5-2-3-6-7(4-5)25-12(21,22)24-6/h2-4,23H,1H3 |
| InChIKey | OYGKRTKYWRIROQ-UHFFFAOYSA-N |
| XLogP | -3.06 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.31 |
| LogP ≤ 5 | -3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|