C15H18B2N2O — CID 174065221
CID 174065221 (PubChem CID 174065221) has the molecular formula C15H18B2N2O and a molecular weight of 263.95 g/mol.
| Compound Name | CID 174065221 |
|---|---|
| PubChem CID | 174065221 |
| Molecular Formula | C15H18B2N2O |
| Molecular Weight | 263.95 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | — |
| SMILES | [B]C([B])([C@@H](C)N(C)C)n1ccc2c3c(ccc21)OCC3 |
| InChI | InChI=1S/C15H18B2N2O/c1-10(18(2)3)15(16,17)19-8-6-11-12-7-9-20-14(12)5-4-13(11)19/h4-6,8,10H,7,9H2,1-3H3/t10-/m1/s1 |
| InChIKey | RSTHQLDHODSMGR-SNVBAGLBSA-N |
| XLogP | 1.47 |
| TPSA | 17.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.95 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|