C22H16N2O2 — CID 174084976
(4E)-2-[(E)-1,3-dihydroindol-2-ylidenemethyl]-3-hydroxy-4-(3H-indol-2-ylmethylidene)cyclobut-2-en-1-one (PubChem CID 174084976) has the molecular formula C22H16N2O2 and a molecular weight of 340.38 g/mol. Its IUPAC name is (4E)-2-[(E)-1,3-dihydroindol-2-ylidenemethyl]-3-hydroxy-4-(3H-indol-2-ylmethylidene)cyclobut-2-en-1-one.
| Compound Name | (4E)-2-[(E)-1,3-dihydroindol-2-ylidenemethyl]-3-hydroxy-4-(3H-indol-2-ylmethylidene)cyclobut-2-en-1-one |
|---|---|
| PubChem CID | 174084976 |
| Molecular Formula | C22H16N2O2 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | (4E)-2-[(E)-1,3-dihydroindol-2-ylidenemethyl]-3-hydroxy-4-(3H-indol-2-ylmethylidene)cyclobut-2-en-1-one |
| SMILES | O=C1C(/C=C2\Cc3ccccc3N2)=C(O)/C1=C\C1=Nc2ccccc2C1 |
| InChI | InChI=1S/C22H16N2O2/c25-21-17(11-15-9-13-5-1-3-7-19(13)23-15)22(26)18(21)12-16-10-14-6-2-4-8-20(14)24-16/h1-8,11-12,23,25H,9-10H2/b15-11+,18-12+ |
| InChIKey | SLLAYEFBNAGONP-KFGDLTOCSA-N |
| XLogP | 4.19 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|