C19H20N4 — CID 174085117
4-imino-3-(8,9,10,11-tetrahydro-6H-pyrrolo[3,2-a]phenanthridin-7-yl)but-2-en-2-amine (PubChem CID 174085117) has the molecular formula C19H20N4 and a molecular weight of 304.40 g/mol. Its IUPAC name is 4-imino-3-(8,9,10,11-tetrahydro-6H-pyrrolo[3,2-a]phenanthridin-7-yl)but-2-en-2-amine.
| Compound Name | 4-imino-3-(8,9,10,11-tetrahydro-6H-pyrrolo[3,2-a]phenanthridin-7-yl)but-2-en-2-amine |
|---|---|
| PubChem CID | 174085117 |
| Molecular Formula | C19H20N4 |
| Molecular Weight | 304.40 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | 4-imino-3-(8,9,10,11-tetrahydro-6H-pyrrolo[3,2-a]phenanthridin-7-yl)but-2-en-2-amine |
| SMILES | [H]/N=C/C(=C(C)N)c1[nH]c2ccc3nccc3c2c2c1CCCC2 |
| InChI | InChI=1S/C19H20N4/c1-11(21)15(10-20)19-13-5-3-2-4-12(13)18-14-8-9-22-16(14)6-7-17(18)23-19/h6-10,20,23H,2-5,21H2,1H3/b15-11?,20-10+ |
| InChIKey | FKLQPJWDGMIRMG-ZAKJPKGJSA-N |
| XLogP | 3.93 |
| TPSA | 78.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.40 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|